C12H20N2O9S3 — CID 3042390
2,5-bis(methylsulfonyloxy)benzenesulfonic acid;piperazine (PubChem CID 3042390) has the molecular formula C12H20N2O9S3 and a molecular weight of 432.50 g/mol. Its IUPAC name is 2,5-bis(methylsulfonyloxy)benzenesulfonic acid;piperazine.
| Compound Name | 2,5-bis(methylsulfonyloxy)benzenesulfonic acid;piperazine |
|---|---|
| PubChem CID | 3042390 |
| Molecular Formula | C12H20N2O9S3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | 2,5-bis(methylsulfonyloxy)benzenesulfonic acid;piperazine |
| SMILES | C1CNCCN1.CS(=O)(=O)Oc1ccc(OS(C)(=O)=O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C8H10O9S3.C4H10N2/c1-18(9,10)16-6-3-4-7(17-19(2,11)12)8(5-6)20(13,14)15;1-2-6-4-3-5-1/h3-5H,1-2H3,(H,13,14,15);5-6H,1-4H2 |
| InChIKey | DYACBXXDFPHBPL-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|