C12H13NO — CID 87591795
7-methyl-5-prop-2-ynoxy-2,3-dihydro-1H-indole (PubChem CID 87591795) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 7-methyl-5-prop-2-ynoxy-2,3-dihydro-1H-indole.
| Compound Name | 7-methyl-5-prop-2-ynoxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 87591795 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 7-methyl-5-prop-2-ynoxy-2,3-dihydro-1H-indole |
| SMILES | C#CCOc1cc(C)c2c(c1)CCN2 |
| InChI | InChI=1S/C12H13NO/c1-3-6-14-11-7-9(2)12-10(8-11)4-5-13-12/h1,7-8,13H,4-6H2,2H3 |
| InChIKey | IQVZZRNUIXPLQQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|