C42H44O6 — CID 25229351
5,17-ditert-butyl-11,23-bis(prop-2-ynoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol (PubChem CID 25229351) has the molecular formula C42H44O6 and a molecular weight of 644.81 g/mol. Its IUPAC name is 5,17-ditert-butyl-11,23-bis(prop-2-ynoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol.
| Compound Name | 5,17-ditert-butyl-11,23-bis(prop-2-ynoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
|---|---|
| PubChem CID | 25229351 |
| Molecular Formula | C42H44O6 |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | 5,17-ditert-butyl-11,23-bis(prop-2-ynoxy)pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-25,26,27,28-tetrol |
| SMILES | C#CCOc1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(OCC#C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C42H44O6/c1-9-11-47-35-21-29-13-25-17-33(41(3,4)5)19-27(37(25)43)15-31-23-36(48-12-10-2)24-32(40(31)46)16-28-20-34(42(6,7)8)18-26(38(28)44)14-30(22-35)39(29)45/h1-2,17-24,43-46H,11-16H2,3-8H3 |
| InChIKey | JTTWDQRSISYALM-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|