C50H62O6 — CID 25135589
methyl 2-[(5,11,17,23-tetratert-butyl-26,28-dihydroxy-27-prop-2-ynoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]acetate (PubChem CID 25135589) has the molecular formula C50H62O6 and a molecular weight of 759.04 g/mol. Its IUPAC name is methyl 2-[(5,11,17,23-tetratert-butyl-26,28-dihydroxy-27-prop-2-ynoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]acetate.
| Compound Name | methyl 2-[(5,11,17,23-tetratert-butyl-26,28-dihydroxy-27-prop-2-ynoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]acetate |
|---|---|
| PubChem CID | 25135589 |
| Molecular Formula | C50H62O6 |
| Molecular Weight | 759.04 g/mol |
| Exact Mass | 758.45 |
| IUPAC Name | methyl 2-[(5,11,17,23-tetratert-butyl-26,28-dihydroxy-27-prop-2-ynoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl)oxy]acetate |
| SMILES | C#CCOc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1O)Cc1cc(C(C)(C)C)cc(c1OCC(=O)OC)Cc1cc(C(C)(C)C)cc(c1O)C2 |
| InChI | InChI=1S/C50H62O6/c1-15-16-55-45-34-17-30-21-38(47(2,3)4)23-32(43(30)52)19-36-27-41(50(11,12)13)28-37(46(36)56-29-42(51)54-14)20-33-24-39(48(5,6)7)22-31(44(33)53)18-35(45)26-40(25-34)49(8,9)10/h1,21-28,52-53H,16-20,29H2,2-14H3 |
| InChIKey | DNLZYLWSTNCKJW-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.04 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|