C55H76O6 — CID 132563839
methyl 2-[(26-butoxy-5,11,17,23-tetratert-butyl-28-methoxy-27-propoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl)oxy]acetate (PubChem CID 132563839) has the molecular formula C55H76O6 and a molecular weight of 833.21 g/mol. Its IUPAC name is methyl 2-[(26-butoxy-5,11,17,23-tetratert-butyl-28-methoxy-27-propoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl)oxy]acetate.
| Compound Name | methyl 2-[(26-butoxy-5,11,17,23-tetratert-butyl-28-methoxy-27-propoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl)oxy]acetate |
|---|---|
| PubChem CID | 132563839 |
| Molecular Formula | C55H76O6 |
| Molecular Weight | 833.21 g/mol |
| Exact Mass | 832.56 |
| IUPAC Name | methyl 2-[(26-butoxy-5,11,17,23-tetratert-butyl-28-methoxy-27-propoxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(25),3,5,7(28),9(27),10,12,15(26),16,18,21,23-dodecaenyl)oxy]acetate |
| SMILES | CCCCOc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCC(=O)OC)Cc1cc(C(C)(C)C)cc(c1OC)Cc1cc(C(C)(C)C)cc(c1OCCC)C2 |
| InChI | InChI=1S/C55H76O6/c1-17-19-21-60-50-39-24-38-29-44(53(6,7)8)28-37(49(38)59-20-18-2)22-35-26-43(52(3,4)5)27-36(48(35)58-16)23-41-32-46(55(12,13)14)33-42(51(41)61-34-47(56)57-15)25-40(50)31-45(30-39)54(9,10)11/h26-33H,17-25,34H2,1-16H3 |
| InChIKey | RHFDFPUFDSCLFB-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.21 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|