C62H92O6 — CID 101332525
29,30,31,32-tetrabutoxy-5,13,19,27-tetratert-butyl-9,23-dioxapentacyclo[23.3.1.13,7.111,15.117,21]dotriaconta-1(29),3(32),4,6,11,13,15(31),17(30),18,20,25,27-dodecaene (PubChem CID 101332525) has the molecular formula C62H92O6 and a molecular weight of 933.41 g/mol. Its IUPAC name is 29,30,31,32-tetrabutoxy-5,13,19,27-tetratert-butyl-9,23-dioxapentacyclo[23.3.1.13,7.111,15.117,21]dotriaconta-1(29),3(32),4,6,11,13,15(31),17(30),18,20,25,27-dodecaene.
| Compound Name | 29,30,31,32-tetrabutoxy-5,13,19,27-tetratert-butyl-9,23-dioxapentacyclo[23.3.1.13,7.111,15.117,21]dotriaconta-1(29),3(32),4,6,11,13,15(31),17(30),18,20,25,27-dodecaene |
|---|---|
| PubChem CID | 101332525 |
| Molecular Formula | C62H92O6 |
| Molecular Weight | 933.41 g/mol |
| Exact Mass | 932.69 |
| IUPAC Name | 29,30,31,32-tetrabutoxy-5,13,19,27-tetratert-butyl-9,23-dioxapentacyclo[23.3.1.13,7.111,15.117,21]dotriaconta-1(29),3(32),4,6,11,13,15(31),17(30),18,20,25,27-dodecaene |
| SMILES | CCCCOc1c2cc(C(C)(C)C)cc1Cc1cc(C(C)(C)C)cc(c1OCCCC)COCc1cc(C(C)(C)C)cc(c1OCCCC)Cc1cc(C(C)(C)C)cc(c1OCCCC)COC2 |
| InChI | InChI=1S/C62H92O6/c1-17-21-25-65-55-43-29-44-32-52(60(8,9)10)37-49(56(44)66-26-22-18-2)41-64-42-50-38-54(62(14,15)16)34-46(58(50)68-28-24-20-4)30-45-33-53(61(11,12)13)36-48(57(45)67-27-23-19-3)40-63-39-47(55)35-51(31-43)59(5,6)7/h31-38H,17-30,39-42H2,1-16H3 |
| InChIKey | XNSIRRHOUXFYJO-UHFFFAOYSA-N |
| XLogP | 16.52 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.41 |
| LogP ≤ 5 | 16.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|