C50H59ClN2O5 — CID 101392849
2-[[5,11,17,23-tetratert-butyl-26,28-bis(cyanomethoxy)-27-hydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]oxy]acetyl chloride (PubChem CID 101392849) has the molecular formula C50H59ClN2O5 and a molecular weight of 803.48 g/mol. Its IUPAC name is 2-[[5,11,17,23-tetratert-butyl-26,28-bis(cyanomethoxy)-27-hydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]oxy]acetyl chloride.
| Compound Name | 2-[[5,11,17,23-tetratert-butyl-26,28-bis(cyanomethoxy)-27-hydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]oxy]acetyl chloride |
|---|---|
| PubChem CID | 101392849 |
| Molecular Formula | C50H59ClN2O5 |
| Molecular Weight | 803.48 g/mol |
| Exact Mass | 802.41 |
| IUPAC Name | 2-[[5,11,17,23-tetratert-butyl-26,28-bis(cyanomethoxy)-27-hydroxy-25-pentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaenyl]oxy]acetyl chloride |
| SMILES | CC(C)(C)c1cc2c(O)c(c1)Cc1cc(C(C)(C)C)cc(c1OCC#N)Cc1cc(C(C)(C)C)cc(c1OCC(=O)Cl)Cc1cc(C(C)(C)C)cc(c1OCC#N)C2 |
| InChI | InChI=1S/C50H59ClN2O5/c1-47(2,3)38-21-30-17-32-23-39(48(4,5)6)25-34(44(32)56-15-13-52)19-36-27-41(50(10,11)12)28-37(46(36)58-29-42(51)54)20-35-26-40(49(7,8)9)24-33(45(35)57-16-14-53)18-31(22-38)43(30)55/h21-28,55H,15-20,29H2,1-12H3 |
| InChIKey | ZZUPRAJTYUUCFO-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.48 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|