C28H23NO15S3 — CID 73357198
25,26,27,28-tetrahydroxy-23-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid (PubChem CID 73357198) has the molecular formula C28H23NO15S3 and a molecular weight of 709.69 g/mol. Its IUPAC name is 25,26,27,28-tetrahydroxy-23-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid.
| Compound Name | 25,26,27,28-tetrahydroxy-23-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
|---|---|
| PubChem CID | 73357198 |
| Molecular Formula | C28H23NO15S3 |
| Molecular Weight | 709.69 g/mol |
| Exact Mass | 709.02 |
| IUPAC Name | 25,26,27,28-tetrahydroxy-23-nitropentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
| SMILES | O=[N+]([O-])c1cc2c(O)c(c1)Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(S(=O)(=O)O)cc(c1O)C2 |
| InChI | InChI=1S/C28H23NO15S3/c30-25-13-1-15-7-22(45(36,37)38)9-17(26(15)31)3-19-11-24(47(42,43)44)12-20(28(19)33)4-18-10-23(46(39,40)41)8-16(27(18)32)2-14(25)6-21(5-13)29(34)35/h5-12,30-33H,1-4H2,(H,36,37,38)(H,39,40,41)(H,42,43,44) |
| InChIKey | HRQXLWVJPDYJQM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 287.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|