C11H16ClN3O5S — CID 174636628
3-(4-methylpiperazin-1-yl)-5-nitrobenzenesulfonic acid;hydrochloride (PubChem CID 174636628) has the molecular formula C11H16ClN3O5S and a molecular weight of 337.79 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-5-nitrobenzenesulfonic acid;hydrochloride.
| Compound Name | 3-(4-methylpiperazin-1-yl)-5-nitrobenzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 174636628 |
| Molecular Formula | C11H16ClN3O5S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-5-nitrobenzenesulfonic acid;hydrochloride |
| SMILES | CN1CCN(c2cc([N+](=O)[O-])cc(S(=O)(=O)O)c2)CC1.Cl |
| InChI | InChI=1S/C11H15N3O5S.ClH/c1-12-2-4-13(5-3-12)9-6-10(14(15)16)8-11(7-9)20(17,18)19;/h6-8H,2-5H2,1H3,(H,17,18,19);1H |
| InChIKey | HBHBDPXBLALCRO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|