About 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone
1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone (PubChem CID 59625193) has the molecular formula C11H14N2O
and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone |
| PubChem CID | 59625193 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone |
| SMILES | CNc1nc2c(cc1C(C)=O)CCC2 |
| InChI | InChI=1S/C11H14N2O/c1-7(14)9-6-8-4-3-5-10(8)13-11(9)12-2/h6H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | HVTTXFMNNZBYCW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone?
The IUPAC name of 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone (CID 59625193) is 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone.
What is the SMILES notation for 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone?
The canonical SMILES for 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone is CNc1nc2c(cc1C(C)=O)CCC2.
What is the InChIKey of 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone?
The InChIKey is HVTTXFMNNZBYCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O/c1-7(14)9-6-8-4-3-5-10(8)13-11(9)12-2/h6H,3-5H2,1-2H3,(H,12,13).
What are the key properties of 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone?
1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone has a molecular weight of 190.25 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(methylamino)-6,7-dihydro-5H-cyclopenta[b]pyridin-3-yl]ethanone is sourced from PubChem (CID 59625193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).