C27H25FN+ — CID 158838637
1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium (PubChem CID 158838637) has the molecular formula C27H25FN+ and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium.
| Compound Name | 1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium |
|---|---|
| PubChem CID | 158838637 |
| Molecular Formula | C27H25FN+ |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium |
| SMILES | Cc1cc(F)c(-c2ccccc2)cc1-c1c2cc3c(cc2cc(C)[n+]1C)CCC3 |
| InChI | InChI=1S/C27H25FN/c1-17-12-26(28)24(19-8-5-4-6-9-19)16-23(17)27-25-15-21-11-7-10-20(21)14-22(25)13-18(2)29(27)3/h4-6,8-9,12-16H,7,10-11H2,1-3H3/q+1 |
| InChIKey | DYWLNGNGBCDSFP-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|