C24H26N3+ — CID 147456602
9-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-8-methylbenzo[f]quinazoline (PubChem CID 147456602) has the molecular formula C24H26N3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is 9-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-8-methylbenzo[f]quinazoline.
| Compound Name | 9-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-8-methylbenzo[f]quinazoline |
|---|---|
| PubChem CID | 147456602 |
| Molecular Formula | C24H26N3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 9-[4-(2,2-dimethylpropyl)-1-methylpyridin-1-ium-2-yl]-8-methylbenzo[f]quinazoline |
| SMILES | Cc1cc2ccc3ncncc3c2cc1-c1cc(CC(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C24H26N3/c1-16-10-18-6-7-22-21(14-25-15-26-22)20(18)12-19(16)23-11-17(8-9-27(23)5)13-24(2,3)4/h6-12,14-15H,13H2,1-5H3/q+1 |
| InChIKey | AXYRJXQOZXYKSN-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 29.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|