C18H23FN+ — CID 167365672
2-(5-tert-butyl-4-fluoro-2-methylphenyl)-1,5-dimethylpyridin-1-ium (PubChem CID 167365672) has the molecular formula C18H23FN+ and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-(5-tert-butyl-4-fluoro-2-methylphenyl)-1,5-dimethylpyridin-1-ium.
| Compound Name | 2-(5-tert-butyl-4-fluoro-2-methylphenyl)-1,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 167365672 |
| Molecular Formula | C18H23FN+ |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-(5-tert-butyl-4-fluoro-2-methylphenyl)-1,5-dimethylpyridin-1-ium |
| SMILES | Cc1ccc(-c2cc(C(C)(C)C)c(F)cc2C)[n+](C)c1 |
| InChI | InChI=1S/C18H23FN/c1-12-7-8-17(20(6)11-12)14-10-15(18(3,4)5)16(19)9-13(14)2/h7-11H,1-6H3/q+1 |
| InChIKey | XFAPVKOXUYOJOK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|