C26H38N+ — CID 177074971
5-tert-butyl-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-1-methylpyridin-1-ium (PubChem CID 177074971) has the molecular formula C26H38N+ and a molecular weight of 364.60 g/mol. Its IUPAC name is 5-tert-butyl-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-1-methylpyridin-1-ium.
| Compound Name | 5-tert-butyl-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 177074971 |
| Molecular Formula | C26H38N+ |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.30 |
| IUPAC Name | 5-tert-butyl-2-(1,1,2,2,3,3,6-heptamethylinden-5-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1cc2c(cc1-c1ccc(C(C)(C)C)c[n+]1C)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C26H38N/c1-17-14-20-21(25(7,8)26(9,10)24(20,5)6)15-19(17)22-13-12-18(16-27(22)11)23(2,3)4/h12-16H,1-11H3/q+1 |
| InChIKey | GXRPJOHHWHBQMW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|