C17H23N2+ — CID 169300729
5-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methyl-2-(trideuteriomethyl)pyridine (PubChem CID 169300729) has the molecular formula C17H23N2+ and a molecular weight of 258.40 g/mol. Its IUPAC name is 5-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methyl-2-(trideuteriomethyl)pyridine.
| Compound Name | 5-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methyl-2-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 169300729 |
| Molecular Formula | C17H23N2+ |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | 5-(5-tert-butyl-1-methylpyridin-1-ium-2-yl)-4-methyl-2-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1cc(C)c(-c2ccc(C(C)(C)C)c[n+]2C)cn1 |
| InChI | InChI=1S/C17H23N2/c1-12-9-13(2)18-10-15(12)16-8-7-14(11-19(16)6)17(3,4)5/h7-11H,1-6H3/q+1/i2D3 |
| InChIKey | JPOBRBUMFBLFST-BMSJAHLVSA-N |
| XLogP | 3.49 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|