C17H22N+ — CID 169015319
5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-1-methyl-2-(2,3,4,5-tetradeuterio-6-methylphenyl)pyridin-1-ium (PubChem CID 169015319) has the molecular formula C17H22N+ and a molecular weight of 253.45 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-1-methyl-2-(2,3,4,5-tetradeuterio-6-methylphenyl)pyridin-1-ium.
| Compound Name | 5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-1-methyl-2-(2,3,4,5-tetradeuterio-6-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 169015319 |
| Molecular Formula | C17H22N+ |
| Molecular Weight | 253.45 g/mol |
| Exact Mass | 253.26 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-1-methyl-2-(2,3,4,5-tetradeuterio-6-methylphenyl)pyridin-1-ium |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c[n+]2C)c(C)c1[2H] |
| InChI | InChI=1S/C17H22N/c1-13-8-6-7-9-15(13)16-11-10-14(12-18(16)5)17(2,3)4/h6-12H,1-5H3/q+1/i2D3,3D3,4D3,6D,7D,8D,9D |
| InChIKey | MKZQNSZZHQGCBO-AMMHPYCYSA-N |
| XLogP | 3.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|