C21H31FNSi+ — CID 171724066
[6-(4-tert-butyl-5-fluoro-2-methylphenyl)-1,4-dimethylpyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 171724066) has the molecular formula C21H31FNSi+ and a molecular weight of 344.57 g/mol. Its IUPAC name is [6-(4-tert-butyl-5-fluoro-2-methylphenyl)-1,4-dimethylpyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [6-(4-tert-butyl-5-fluoro-2-methylphenyl)-1,4-dimethylpyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 171724066 |
| Molecular Formula | C21H31FNSi+ |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | [6-(4-tert-butyl-5-fluoro-2-methylphenyl)-1,4-dimethylpyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | Cc1cc(C(C)(C)C)c(F)cc1-c1cc(C)c([Si](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C21H31FNSi/c1-14-10-17(21(3,4)5)18(22)12-16(14)19-11-15(2)20(13-23(19)6)24(7,8)9/h10-13H,1-9H3/q+1 |
| InChIKey | BMWZATYGZKKBJY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|