C18H23F3NSi+ — CID 171724044
[1,4-dimethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 171724044) has the molecular formula C18H23F3NSi+ and a molecular weight of 338.47 g/mol. Its IUPAC name is [1,4-dimethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [1,4-dimethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 171724044 |
| Molecular Formula | C18H23F3NSi+ |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [1,4-dimethyl-6-[2-methyl-5-(trifluoromethyl)phenyl]pyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | Cc1ccc(C(F)(F)F)cc1-c1cc(C)c([Si](C)(C)C)c[n+]1C |
| InChI | InChI=1S/C18H23F3NSi/c1-12-7-8-14(18(19,20)21)10-15(12)16-9-13(2)17(11-22(16)3)23(4,5)6/h7-11H,1-6H3/q+1 |
| InChIKey | TUBHPTBXRBELHG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|