C24H38NSi+ — CID 167365261
[4-(3-ethyl-3-methylpentan-2-yl)-1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-trimethylsilane (PubChem CID 167365261) has the molecular formula C24H38NSi+ and a molecular weight of 368.66 g/mol. Its IUPAC name is [4-(3-ethyl-3-methylpentan-2-yl)-1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-trimethylsilane.
| Compound Name | [4-(3-ethyl-3-methylpentan-2-yl)-1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 167365261 |
| Molecular Formula | C24H38NSi+ |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | [4-(3-ethyl-3-methylpentan-2-yl)-1-methyl-6-(2-methylphenyl)pyridin-1-ium-3-yl]-trimethylsilane |
| SMILES | CCC(C)(CC)C(C)c1cc(-c2ccccc2C)[n+](C)cc1[Si](C)(C)C |
| InChI | InChI=1S/C24H38NSi/c1-10-24(5,11-2)19(4)21-16-22(20-15-13-12-14-18(20)3)25(6)17-23(21)26(7,8)9/h12-17,19H,10-11H2,1-9H3/q+1 |
| InChIKey | XJMHQVWPURBWOU-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|