C11H15ClO2 — CID 117306109
2-(2-chloro-6-methoxy-3,5-dimethylphenyl)ethanol (PubChem CID 117306109) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 2-(2-chloro-6-methoxy-3,5-dimethylphenyl)ethanol.
| Compound Name | 2-(2-chloro-6-methoxy-3,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 117306109 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(2-chloro-6-methoxy-3,5-dimethylphenyl)ethanol |
| SMILES | COc1c(C)cc(C)c(Cl)c1CCO |
| InChI | InChI=1S/C11H15ClO2/c1-7-6-8(2)11(14-3)9(4-5-13)10(7)12/h6,13H,4-5H2,1-3H3 |
| InChIKey | MMPXEPHSNGDHQV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |