C11H15ClN2 — CID 167100568
6-chloro-2,5-dimethyl-N-(2-methylprop-2-enyl)pyridin-3-amine (PubChem CID 167100568) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 6-chloro-2,5-dimethyl-N-(2-methylprop-2-enyl)pyridin-3-amine.
| Compound Name | 6-chloro-2,5-dimethyl-N-(2-methylprop-2-enyl)pyridin-3-amine |
|---|---|
| PubChem CID | 167100568 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 6-chloro-2,5-dimethyl-N-(2-methylprop-2-enyl)pyridin-3-amine |
| SMILES | C=C(C)CNc1cc(C)c(Cl)nc1C |
| InChI | InChI=1S/C11H15ClN2/c1-7(2)6-13-10-5-8(3)11(12)14-9(10)4/h5,13H,1,6H2,2-4H3 |
| InChIKey | WUUNISWKOCHBHM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|