C12H14O4 — CID 117317870
3-(6-hydroxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanal (PubChem CID 117317870) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-(6-hydroxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanal.
| Compound Name | 3-(6-hydroxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanal |
|---|---|
| PubChem CID | 117317870 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-(6-hydroxy-3,4-dihydro-2H-1,5-benzodioxepin-7-yl)propanal |
| SMILES | O=CCCc1ccc2c(c1O)OCCCO2 |
| InChI | InChI=1S/C12H14O4/c13-6-1-3-9-4-5-10-12(11(9)14)16-8-2-7-15-10/h4-6,14H,1-3,7-8H2 |
| InChIKey | NMTACQDNQGFLRK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|