C12H16O3 — CID 117297595
2-(5-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)ethanol (PubChem CID 117297595) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(5-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)ethanol.
| Compound Name | 2-(5-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)ethanol |
|---|---|
| PubChem CID | 117297595 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 2-(5-ethyl-2,3-dihydro-1,4-benzodioxin-6-yl)ethanol |
| SMILES | CCc1c(CCO)ccc2c1OCCO2 |
| InChI | InChI=1S/C12H16O3/c1-2-10-9(5-6-13)3-4-11-12(10)15-8-7-14-11/h3-4,13H,2,5-8H2,1H3 |
| InChIKey | QHQNQPZFGOSYET-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |