About 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene
3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene (PubChem CID 54006719) has the molecular formula C10H10O4
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene.
Analyze 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene?
The IUPAC name of 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene (CID 54006719) is 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene.
What is the SMILES notation for 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene?
The canonical SMILES for 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene is c1cc2c3c(c1OCCO2)OCCO3.
What is the InChIKey of 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene?
The InChIKey is NRXATDNWVAGXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O4/c1-2-8-10-9(13-5-6-14-10)7(1)11-3-4-12-8/h1-2H,3-6H2.
What are the key properties of 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene?
3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene has a molecular weight of 194.19 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6,9,12-tetraoxatricyclo[6.4.2.02,7]tetradeca-1,7,13-triene is sourced from PubChem (CID 54006719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).