C11H13NO2 — CID 178072510
6-cyclopropyl-2,3-dihydro-1,4-benzodioxin-5-amine (PubChem CID 178072510) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 6-cyclopropyl-2,3-dihydro-1,4-benzodioxin-5-amine.
| Compound Name | 6-cyclopropyl-2,3-dihydro-1,4-benzodioxin-5-amine |
|---|---|
| PubChem CID | 178072510 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 6-cyclopropyl-2,3-dihydro-1,4-benzodioxin-5-amine |
| SMILES | Nc1c(C2CC2)ccc2c1OCCO2 |
| InChI | InChI=1S/C11H13NO2/c12-10-8(7-1-2-7)3-4-9-11(10)14-6-5-13-9/h3-4,7H,1-2,5-6,12H2 |
| InChIKey | RMNOCWXJEBWXOT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|