C11H12O2 — CID 54515769
5-cyclopropyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 54515769) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 5-cyclopropyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-cyclopropyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 54515769 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 5-cyclopropyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | c1cc2c(c(C3CC3)c1)OCCO2 |
| InChI | InChI=1S/C11H12O2/c1-2-9(8-4-5-8)11-10(3-1)12-6-7-13-11/h1-3,8H,4-7H2 |
| InChIKey | YMHMOUGWOOLOSY-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |