C14H20N2O2 — CID 82383345
(6S)-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,6-dimethylpiperazine (PubChem CID 82383345) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (6S)-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,6-dimethylpiperazine.
| Compound Name | (6S)-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,6-dimethylpiperazine |
|---|---|
| PubChem CID | 82383345 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (6S)-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-1,6-dimethylpiperazine |
| SMILES | C[C@H]1CNCC(c2cccc3c2OCCO3)N1C |
| InChI | InChI=1S/C14H20N2O2/c1-10-8-15-9-12(16(10)2)11-4-3-5-13-14(11)18-7-6-17-13/h3-5,10,12,15H,6-9H2,1-2H3/t10-,12?/m0/s1 |
| InChIKey | NPKRILRSGYGTEL-NUHJPDEHSA-N |
| XLogP | 1.42 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |