C12H15NO3 — CID 166812127
8-amino-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-9-carbaldehyde (PubChem CID 166812127) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 8-amino-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-9-carbaldehyde.
| Compound Name | 8-amino-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-9-carbaldehyde |
|---|---|
| PubChem CID | 166812127 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 8-amino-3,4,5,6-tetrahydro-2H-1,7-benzodioxonine-9-carbaldehyde |
| SMILES | Nc1c(C=O)ccc2c1OCCCCCO2 |
| InChI | InChI=1S/C12H15NO3/c13-11-9(8-14)4-5-10-12(11)16-7-3-1-2-6-15-10/h4-5,8H,1-3,6-7,13H2 |
| InChIKey | KQMASVFJYBHFIL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|