C10H15NO2 — CID 170590929
2,3-dihydro-1,4-benzodioxin-5-amine;ethane (PubChem CID 170590929) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-5-amine;ethane.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-5-amine;ethane |
|---|---|
| PubChem CID | 170590929 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-5-amine;ethane |
| SMILES | CC.Nc1cccc2c1OCCO2 |
| InChI | InChI=1S/C8H9NO2.C2H6/c9-6-2-1-3-7-8(6)11-5-4-10-7;1-2/h1-3H,4-5,9H2;1-2H3 |
| InChIKey | DNMNFVGGIOOTKV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|