C11H13BrO2 — CID 11780152
5-(3-bromopropyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 11780152) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is 5-(3-bromopropyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-(3-bromopropyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 11780152 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 5-(3-bromopropyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | BrCCCc1cccc2c1OCCO2 |
| InChI | InChI=1S/C11H13BrO2/c12-6-2-4-9-3-1-5-10-11(9)14-8-7-13-10/h1,3,5H,2,4,6-8H2 |
| InChIKey | MHICZBWHHCHIBX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|