C14H20O2 — CID 177208760
5-(4-methylpentyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 177208760) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 5-(4-methylpentyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 5-(4-methylpentyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 177208760 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 5-(4-methylpentyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC(C)CCCc1cccc2c1OCCO2 |
| InChI | InChI=1S/C14H20O2/c1-11(2)5-3-6-12-7-4-8-13-14(12)16-10-9-15-13/h4,7-8,11H,3,5-6,9-10H2,1-2H3 |
| InChIKey | HLEBKVBNYXEJGA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |