C8H7FO2 — CID 175730676
7-deuterio-5-fluoro-2,3-dihydro-1,4-benzodioxine (PubChem CID 175730676) has the molecular formula C8H7FO2 and a molecular weight of 155.15 g/mol. Its IUPAC name is 7-deuterio-5-fluoro-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 7-deuterio-5-fluoro-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 175730676 |
| Molecular Formula | C8H7FO2 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | 7-deuterio-5-fluoro-2,3-dihydro-1,4-benzodioxine |
| SMILES | [2H]c1cc(F)c2c(c1)OCCO2 |
| InChI | InChI=1S/C8H7FO2/c9-6-2-1-3-7-8(6)11-5-4-10-7/h1-3H,4-5H2/i1D |
| InChIKey | DRSLFPHWBGATPA-MICDWDOJSA-N |
| XLogP | 1.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |