C13H15BrF3NO — CID 86649634
2-[4-bromo-2-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide (PubChem CID 86649634) has the molecular formula C13H15BrF3NO and a molecular weight of 338.17 g/mol. Its IUPAC name is 2-[4-bromo-2-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide.
| Compound Name | 2-[4-bromo-2-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 86649634 |
| Molecular Formula | C13H15BrF3NO |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2-[4-bromo-2-(trifluoromethyl)phenyl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)C(C(N)=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO/c1-12(2,3)10(11(18)19)8-5-4-7(14)6-9(8)13(15,16)17/h4-6,10H,1-3H3,(H2,18,19) |
| InChIKey | LASWMEVKJDJZHR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |