C14H19BrF3N — CID 83161775
1-[4-bromo-2-(trifluoromethyl)phenyl]-5-methylhexan-1-amine (PubChem CID 83161775) has the molecular formula C14H19BrF3N and a molecular weight of 338.21 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]-5-methylhexan-1-amine.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-5-methylhexan-1-amine |
|---|---|
| PubChem CID | 83161775 |
| Molecular Formula | C14H19BrF3N |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-5-methylhexan-1-amine |
| SMILES | CC(C)CCCC(N)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H19BrF3N/c1-9(2)4-3-5-13(19)11-7-6-10(15)8-12(11)14(16,17)18/h6-9,13H,3-5,19H2,1-2H3 |
| InChIKey | IAIYDOHOQIFMKY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |