C13H17ClF3N — CID 171227133
(1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]-4-methylpentan-1-amine (PubChem CID 171227133) has the molecular formula C13H17ClF3N and a molecular weight of 279.73 g/mol. Its IUPAC name is (1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]-4-methylpentan-1-amine.
| Compound Name | (1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 171227133 |
| Molecular Formula | C13H17ClF3N |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | (1S)-1-[4-chloro-2-(trifluoromethyl)phenyl]-4-methylpentan-1-amine |
| SMILES | CC(C)CC[C@H](N)c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C13H17ClF3N/c1-8(2)3-6-12(18)10-5-4-9(14)7-11(10)13(15,16)17/h4-5,7-8,12H,3,6,18H2,1-2H3/t12-/m0/s1 |
| InChIKey | MSQHYGNVMHXLEH-LBPRGKRZSA-N |
| XLogP | 4.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |