C11H13BrF3NO — CID 79574373
1-[4-bromo-2-(trifluoromethyl)phenyl]-2-ethoxyethanamine (PubChem CID 79574373) has the molecular formula C11H13BrF3NO and a molecular weight of 312.13 g/mol. Its IUPAC name is 1-[4-bromo-2-(trifluoromethyl)phenyl]-2-ethoxyethanamine.
| Compound Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-2-ethoxyethanamine |
|---|---|
| PubChem CID | 79574373 |
| Molecular Formula | C11H13BrF3NO |
| Molecular Weight | 312.13 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-[4-bromo-2-(trifluoromethyl)phenyl]-2-ethoxyethanamine |
| SMILES | CCOCC(N)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C11H13BrF3NO/c1-2-17-6-10(16)8-4-3-7(12)5-9(8)11(13,14)15/h3-5,10H,2,6,16H2,1H3 |
| InChIKey | ARMVTLIVVDBVNS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.13 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |