C15H22Br2O — CID 114200337
5-bromo-1-(bromomethyl)-2-(2,4-dimethylpentoxy)-3-methylbenzene (PubChem CID 114200337) has the molecular formula C15H22Br2O and a molecular weight of 378.15 g/mol. Its IUPAC name is 5-bromo-1-(bromomethyl)-2-(2,4-dimethylpentoxy)-3-methylbenzene.
| Compound Name | 5-bromo-1-(bromomethyl)-2-(2,4-dimethylpentoxy)-3-methylbenzene |
|---|---|
| PubChem CID | 114200337 |
| Molecular Formula | C15H22Br2O |
| Molecular Weight | 378.15 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 5-bromo-1-(bromomethyl)-2-(2,4-dimethylpentoxy)-3-methylbenzene |
| SMILES | Cc1cc(Br)cc(CBr)c1OCC(C)CC(C)C |
| InChI | InChI=1S/C15H22Br2O/c1-10(2)5-11(3)9-18-15-12(4)6-14(17)7-13(15)8-16/h6-7,10-11H,5,8-9H2,1-4H3 |
| InChIKey | UPQKGCRXDDFUNI-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.15 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|