C16H29N3O2 — CID 82098593
8-nonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 82098593) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 8-nonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-nonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 82098593 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 8-nonyl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CCCCCCCCCN1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C16H29N3O2/c1-2-3-4-5-6-7-8-11-19-12-9-16(10-13-19)14(20)17-15(21)18-16/h2-13H2,1H3,(H2,17,18,20,21) |
| InChIKey | FGSVFDOZUMKBNY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|