C21H30N4O7S — CID 18931312
N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4-dimethoxyphenyl]methanesulfonamide (PubChem CID 18931312) has the molecular formula C21H30N4O7S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4-dimethoxyphenyl]methanesulfonamide.
| Compound Name | N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4-dimethoxyphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18931312 |
| Molecular Formula | C21H30N4O7S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[5-[5-(2,4-dioxo-1,3,8-triazaspiro[4.5]decan-8-yl)pentanoyl]-2,4-dimethoxyphenyl]methanesulfonamide |
| SMILES | COc1cc(OC)c(C(=O)CCCCN2CCC3(CC2)NC(=O)NC3=O)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C21H30N4O7S/c1-31-17-13-18(32-2)15(24-33(3,29)30)12-14(17)16(26)6-4-5-9-25-10-7-21(8-11-25)19(27)22-20(28)23-21/h12-13,24H,4-11H2,1-3H3,(H2,22,23,27,28) |
| InChIKey | BFXGBGSGXWIJQL-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|