C23H22N6O3 — CID 155008888
N-[[1-[(2R)-4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]triazol-4-yl]methyl]pyridine-4-carboxamide (PubChem CID 155008888) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[[1-[(2R)-4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]triazol-4-yl]methyl]pyridine-4-carboxamide.
| Compound Name | N-[[1-[(2R)-4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]triazol-4-yl]methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155008888 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | N-[[1-[(2R)-4-(hydroxyamino)-1-naphthalen-2-yl-4-oxobutan-2-yl]triazol-4-yl]methyl]pyridine-4-carboxamide |
| SMILES | O=C(C[C@@H](Cc1ccc2ccccc2c1)n1cc(CNC(=O)c2ccncc2)nn1)NO |
| InChI | InChI=1S/C23H22N6O3/c30-22(27-32)13-21(12-16-5-6-17-3-1-2-4-19(17)11-16)29-15-20(26-28-29)14-25-23(31)18-7-9-24-10-8-18/h1-11,15,21,32H,12-14H2,(H,25,31)(H,27,30)/t21-/m1/s1 |
| InChIKey | YJLTVRDBTKPBFV-OAQYLSRUSA-N |
| XLogP | 2.44 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|