C25H27F2N9O3 — CID 154997276
N-[[1-[1-[4-(2-tert-butyltetrazol-5-yl)phenyl]-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide (PubChem CID 154997276) has the molecular formula C25H27F2N9O3 and a molecular weight of 539.55 g/mol. Its IUPAC name is N-[[1-[1-[4-(2-tert-butyltetrazol-5-yl)phenyl]-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide.
| Compound Name | N-[[1-[1-[4-(2-tert-butyltetrazol-5-yl)phenyl]-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 154997276 |
| Molecular Formula | C25H27F2N9O3 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | N-[[1-[1-[4-(2-tert-butyltetrazol-5-yl)phenyl]-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide |
| SMILES | CC(C)(C)n1nnc(-c2ccc(CC(CC(=O)NO)n3cc(CNC(=O)c4ccc(F)c(F)c4)nn3)cc2)n1 |
| InChI | InChI=1S/C25H27F2N9O3/c1-25(2,3)36-31-23(30-34-36)16-6-4-15(5-7-16)10-19(12-22(37)32-39)35-14-18(29-33-35)13-28-24(38)17-8-9-20(26)21(27)11-17/h4-9,11,14,19,39H,10,12-13H2,1-3H3,(H,28,38)(H,32,37) |
| InChIKey | KQJSWCZNPFCGQA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 152.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|