C25H27F2N5O3 — CID 154997083
3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]-N-methylbenzamide (PubChem CID 154997083) has the molecular formula C25H27F2N5O3 and a molecular weight of 483.52 g/mol. Its IUPAC name is 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]-N-methylbenzamide.
| Compound Name | 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 154997083 |
| Molecular Formula | C25H27F2N5O3 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(5,6,7,8-tetrahydronaphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]-N-methylbenzamide |
| SMILES | CN(Cc1cn([C@@H](CC(=O)NO)Cc2ccc3c(c2)CCCC3)nn1)C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C25H27F2N5O3/c1-31(25(34)19-8-9-22(26)23(27)12-19)14-20-15-32(30-28-20)21(13-24(33)29-35)11-16-6-7-17-4-2-3-5-18(17)10-16/h6-10,12,15,21,35H,2-5,11,13-14H2,1H3,(H,29,33)/t21-/m1/s1 |
| InChIKey | CHYXFCJYIBWIBS-OAQYLSRUSA-N |
| XLogP | 3.39 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|