C24H23F2N5O4 — CID 163416737
3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]benzamide (PubChem CID 163416737) has the molecular formula C24H23F2N5O4 and a molecular weight of 483.48 g/mol. Its IUPAC name is 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]benzamide.
| Compound Name | 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 163416737 |
| Molecular Formula | C24H23F2N5O4 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(6-oxo-7,8-dihydro-5H-naphthalen-2-yl)butan-2-yl]triazol-4-yl]methyl]benzamide |
| SMILES | O=C1CCc2cc(C[C@H](CC(=O)NO)n3cc(CNC(=O)c4ccc(F)c(F)c4)nn3)ccc2C1 |
| InChI | InChI=1S/C24H23F2N5O4/c25-21-6-4-17(10-22(21)26)24(34)27-12-18-13-31(30-28-18)19(11-23(33)29-35)8-14-1-2-16-9-20(32)5-3-15(16)7-14/h1-2,4,6-7,10,13,19,35H,3,5,8-9,11-12H2,(H,27,34)(H,29,33)/t19-/m1/s1 |
| InChIKey | AFBCQYUFDCGXOO-LJQANCHMSA-N |
| XLogP | 2.22 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|