C24H22FN7O3 — CID 154647394
4-fluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(4-pyrimidin-5-ylphenyl)butan-2-yl]triazol-4-yl]methyl]benzamide (PubChem CID 154647394) has the molecular formula C24H22FN7O3 and a molecular weight of 475.48 g/mol. Its IUPAC name is 4-fluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(4-pyrimidin-5-ylphenyl)butan-2-yl]triazol-4-yl]methyl]benzamide.
| Compound Name | 4-fluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(4-pyrimidin-5-ylphenyl)butan-2-yl]triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 154647394 |
| Molecular Formula | C24H22FN7O3 |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 4-fluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-(4-pyrimidin-5-ylphenyl)butan-2-yl]triazol-4-yl]methyl]benzamide |
| SMILES | O=C(C[C@@H](Cc1ccc(-c2cncnc2)cc1)n1cc(CNC(=O)c2ccc(F)cc2)nn1)NO |
| InChI | InChI=1S/C24H22FN7O3/c25-20-7-5-18(6-8-20)24(34)28-13-21-14-32(31-29-21)22(10-23(33)30-35)9-16-1-3-17(4-2-16)19-11-26-15-27-12-19/h1-8,11-12,14-15,22,35H,9-10,13H2,(H,28,34)(H,30,33)/t22-/m1/s1 |
| InChIKey | YRZMOJJNYILONE-JOCHJYFZSA-N |
| XLogP | 2.48 |
| TPSA | 134.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|