C20H19BrFN5O3 — CID 154996796
N-[[1-[(2R)-1-(4-bromophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-4-fluorobenzamide (PubChem CID 154996796) has the molecular formula C20H19BrFN5O3 and a molecular weight of 476.31 g/mol. Its IUPAC name is N-[[1-[(2R)-1-(4-bromophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-4-fluorobenzamide.
| Compound Name | N-[[1-[(2R)-1-(4-bromophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 154996796 |
| Molecular Formula | C20H19BrFN5O3 |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | N-[[1-[(2R)-1-(4-bromophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-4-fluorobenzamide |
| SMILES | O=C(C[C@@H](Cc1ccc(Br)cc1)n1cc(CNC(=O)c2ccc(F)cc2)nn1)NO |
| InChI | InChI=1S/C20H19BrFN5O3/c21-15-5-1-13(2-6-15)9-18(10-19(28)25-30)27-12-17(24-26-27)11-23-20(29)14-3-7-16(22)8-4-14/h1-8,12,18,30H,9-11H2,(H,23,29)(H,25,28)/t18-/m1/s1 |
| InChIKey | HLBBVGOMFTWKOE-GOSISDBHSA-N |
| XLogP | 2.79 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|