C21H18F2N6O3S — CID 154997041
N-[[1-[(2R)-1-(1,3-benzothiazol-6-yl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide (PubChem CID 154997041) has the molecular formula C21H18F2N6O3S and a molecular weight of 472.48 g/mol. Its IUPAC name is N-[[1-[(2R)-1-(1,3-benzothiazol-6-yl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide.
| Compound Name | N-[[1-[(2R)-1-(1,3-benzothiazol-6-yl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 154997041 |
| Molecular Formula | C21H18F2N6O3S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | N-[[1-[(2R)-1-(1,3-benzothiazol-6-yl)-4-(hydroxyamino)-4-oxobutan-2-yl]triazol-4-yl]methyl]-3,4-difluorobenzamide |
| SMILES | O=C(C[C@@H](Cc1ccc2ncsc2c1)n1cc(CNC(=O)c2ccc(F)c(F)c2)nn1)NO |
| InChI | InChI=1S/C21H18F2N6O3S/c22-16-3-2-13(7-17(16)23)21(31)24-9-14-10-29(28-26-14)15(8-20(30)27-32)5-12-1-4-18-19(6-12)33-11-25-18/h1-4,6-7,10-11,15,32H,5,8-9H2,(H,24,31)(H,27,30)/t15-/m1/s1 |
| InChIKey | YIOVYFVNKHCMAZ-OAHLLOKOSA-N |
| XLogP | 2.78 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|