C21H18F5N5O3 — CID 155008857
3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]triazol-4-yl]methyl]benzamide (PubChem CID 155008857) has the molecular formula C21H18F5N5O3 and a molecular weight of 483.40 g/mol. Its IUPAC name is 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]triazol-4-yl]methyl]benzamide.
| Compound Name | 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]triazol-4-yl]methyl]benzamide |
|---|---|
| PubChem CID | 155008857 |
| Molecular Formula | C21H18F5N5O3 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 3,4-difluoro-N-[[1-[(2R)-4-(hydroxyamino)-4-oxo-1-[4-(trifluoromethyl)phenyl]butan-2-yl]triazol-4-yl]methyl]benzamide |
| SMILES | O=C(C[C@@H](Cc1ccc(C(F)(F)F)cc1)n1cc(CNC(=O)c2ccc(F)c(F)c2)nn1)NO |
| InChI | InChI=1S/C21H18F5N5O3/c22-17-6-3-13(8-18(17)23)20(33)27-10-15-11-31(30-28-15)16(9-19(32)29-34)7-12-1-4-14(5-2-12)21(24,25)26/h1-6,8,11,16,34H,7,9-10H2,(H,27,33)(H,29,32)/t16-/m1/s1 |
| InChIKey | SCAVJFRIQGGXOM-MRXNPFEDSA-N |
| XLogP | 3.18 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|