C23H22FN5O5S2 — CID 175485886
1-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]-4-[[(5-phenylthiophen-2-yl)-sulfinoamino]methyl]triazole (PubChem CID 175485886) has the molecular formula C23H22FN5O5S2 and a molecular weight of 531.59 g/mol. Its IUPAC name is 1-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]-4-[[(5-phenylthiophen-2-yl)-sulfinoamino]methyl]triazole.
| Compound Name | 1-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]-4-[[(5-phenylthiophen-2-yl)-sulfinoamino]methyl]triazole |
|---|---|
| PubChem CID | 175485886 |
| Molecular Formula | C23H22FN5O5S2 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | 1-[(2S)-1-(3-fluoro-4-hydroxyphenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]-4-[[(5-phenylthiophen-2-yl)-sulfinoamino]methyl]triazole |
| SMILES | O=C(C[C@H](Cc1ccc(O)c(F)c1)n1cc(CN(c2ccc(-c3ccccc3)s2)S(=O)O)nn1)NO |
| InChI | InChI=1S/C23H22FN5O5S2/c24-19-11-15(6-7-20(19)30)10-18(12-22(31)26-32)28-13-17(25-27-28)14-29(36(33)34)23-9-8-21(35-23)16-4-2-1-3-5-16/h1-9,11,13,18,30,32H,10,12,14H2,(H,26,31)(H,33,34)/t18-/m0/s1 |
| InChIKey | WOWLUEAOYDOIMT-SFHVURJKSA-N |
| XLogP | 3.67 |
| TPSA | 140.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|