C23H22N5O5S2- — CID 175485877
1-[(2R)-4-(hydroxyamino)-1-(4-hydroxyphenyl)-4-oxobutan-2-yl]-5-[[(5-phenylthiophen-2-yl)-sulfinatoamino]methyl]triazole (PubChem CID 175485877) has the molecular formula C23H22N5O5S2- and a molecular weight of 512.59 g/mol. Its IUPAC name is 1-[(2R)-4-(hydroxyamino)-1-(4-hydroxyphenyl)-4-oxobutan-2-yl]-5-[[(5-phenylthiophen-2-yl)-sulfinatoamino]methyl]triazole.
| Compound Name | 1-[(2R)-4-(hydroxyamino)-1-(4-hydroxyphenyl)-4-oxobutan-2-yl]-5-[[(5-phenylthiophen-2-yl)-sulfinatoamino]methyl]triazole |
|---|---|
| PubChem CID | 175485877 |
| Molecular Formula | C23H22N5O5S2- |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 1-[(2R)-4-(hydroxyamino)-1-(4-hydroxyphenyl)-4-oxobutan-2-yl]-5-[[(5-phenylthiophen-2-yl)-sulfinatoamino]methyl]triazole |
| SMILES | O=C(C[C@@H](Cc1ccc(O)cc1)n1nncc1CN(c1ccc(-c2ccccc2)s1)S(=O)[O-])NO |
| InChI | InChI=1S/C23H23N5O5S2/c29-20-8-6-16(7-9-20)12-18(13-22(30)25-31)28-19(14-24-26-28)15-27(35(32)33)23-11-10-21(34-23)17-4-2-1-3-5-17/h1-11,14,18,29,31H,12-13,15H2,(H,25,30)(H,32,33)/p-1/t18-/m1/s1 |
| InChIKey | FVPMMONIYKXLAV-GOSISDBHSA-M |
| XLogP | 3.19 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|