C22H19ClN2O4S2 — CID 6736564
benzyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoate (PubChem CID 6736564) has the molecular formula C22H19ClN2O4S2 and a molecular weight of 474.99 g/mol. Its IUPAC name is benzyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | benzyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 6736564 |
| Molecular Formula | C22H19ClN2O4S2 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | benzyl 2-[(5-chlorothiophen-2-yl)sulfonylamino]-3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(OCc1ccccc1)C(Cc1c[nH]c2ccccc12)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C22H19ClN2O4S2/c23-20-10-11-21(30-20)31(27,28)25-19(22(26)29-14-15-6-2-1-3-7-15)12-16-13-24-18-9-5-4-8-17(16)18/h1-11,13,19,24-25H,12,14H2 |
| InChIKey | JABCKOHKWKMLGZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |